About 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea
1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea (PubChem CID 10386145) has the molecular formula C21H20F2N4O2
and a molecular weight of 398.41 g/mol. Its IUPAC name is 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea.
Molecular Properties
| Compound Name | 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea |
| PubChem CID | 10386145 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(NCc1cc(F)c(N2CCOCC2)c(F)c1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C21H20F2N4O2/c22-17-10-14(11-18(23)20(17)27-6-8-29-9-7-27)12-25-21(28)26-19-3-1-2-15-13-24-5-4-16(15)19/h1-5,10-11,13H,6-9,12H2,(H2,25,26,28) |
| InChIKey | FDYDLNUOWBFZCG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea?
The IUPAC name of 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea (CID 10386145) is 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea.
What is the SMILES notation for 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea?
The canonical SMILES for 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea is O=C(NCc1cc(F)c(N2CCOCC2)c(F)c1)Nc1cccc2cnccc12.
What is the InChIKey of 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea?
The InChIKey is FDYDLNUOWBFZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2N4O2/c22-17-10-14(11-18(23)20(17)27-6-8-29-9-7-27)12-25-21(28)26-19-3-1-2-15-13-24-5-4-16(15)19/h1-5,10-11,13H,6-9,12H2,(H2,25,26,28).
What are the key properties of 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea?
1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea has a molecular weight of 398.41 g/mol, XLogP of 3.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-3-isoquinolin-5-ylurea is sourced from PubChem (CID 10386145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).