C25H38N2O2 — CID 10386173
(E,7S)-N-[2-(1H-indol-3-yl)ethyl]-7-methoxytetradec-4-enamide (PubChem CID 10386173) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (E,7S)-N-[2-(1H-indol-3-yl)ethyl]-7-methoxytetradec-4-enamide.
| Compound Name | (E,7S)-N-[2-(1H-indol-3-yl)ethyl]-7-methoxytetradec-4-enamide |
|---|---|
| PubChem CID | 10386173 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (E,7S)-N-[2-(1H-indol-3-yl)ethyl]-7-methoxytetradec-4-enamide |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)NCCc1c[nH]c2ccccc12)OC |
| InChI | InChI=1S/C25H38N2O2/c1-3-4-5-6-8-13-22(29-2)14-9-7-10-17-25(28)26-19-18-21-20-27-24-16-12-11-15-23(21)24/h7,9,11-12,15-16,20,22,27H,3-6,8,10,13-14,17-19H2,1-2H3,(H,26,28)/b9-7+/t22-/m0/s1 |
| InChIKey | OHYDYQKPXIXRBQ-GLJAUCNMSA-N |
| XLogP | 5.93 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|