C14H20N2O4 — CID 103861972
N-(5-hydroxy-4-methylpentyl)-3-methyl-4-nitrobenzamide (PubChem CID 103861972) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-(5-hydroxy-4-methylpentyl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(5-hydroxy-4-methylpentyl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 103861972 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(5-hydroxy-4-methylpentyl)-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCCCC(C)CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O4/c1-10(9-17)4-3-7-15-14(18)12-5-6-13(16(19)20)11(2)8-12/h5-6,8,10,17H,3-4,7,9H2,1-2H3,(H,15,18) |
| InChIKey | YNCRZDHKPQAGAE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|