C11H15NO6S2 — CID 103862434
(2S)-2-(2-methylsulfonylethylsulfonylamino)-2-phenylacetic acid (PubChem CID 103862434) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2S)-2-(2-methylsulfonylethylsulfonylamino)-2-phenylacetic acid.
| Compound Name | (2S)-2-(2-methylsulfonylethylsulfonylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 103862434 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | (2S)-2-(2-methylsulfonylethylsulfonylamino)-2-phenylacetic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO6S2/c1-19(15,16)7-8-20(17,18)12-10(11(13)14)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | BPYOHMYIWLBQBA-JTQLQIEISA-N |
| XLogP | -0.22 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |