About 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide
4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide (PubChem CID 103862856) has the molecular formula C11H13N3O3S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide |
| PubChem CID | 103862856 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide |
| SMILES | N#CC1(C(=O)NCc2csc(=O)[nH]2)CCOCC1 |
| InChI | InChI=1S/C11H13N3O3S/c12-7-11(1-3-17-4-2-11)9(15)13-5-8-6-18-10(16)14-8/h6H,1-5H2,(H,13,15)(H,14,16) |
| InChIKey | ONSXHWVYYZHPQR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide?
The IUPAC name of 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide (CID 103862856) is 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide.
What is the SMILES notation for 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide?
The canonical SMILES for 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide is N#CC1(C(=O)NCc2csc(=O)[nH]2)CCOCC1.
What is the InChIKey of 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide?
The InChIKey is ONSXHWVYYZHPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3S/c12-7-11(1-3-17-4-2-11)9(15)13-5-8-6-18-10(16)14-8/h6H,1-5H2,(H,13,15)(H,14,16).
What are the key properties of 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide?
4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide has a molecular weight of 267.31 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]oxane-4-carboxamide is sourced from PubChem (CID 103862856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).