C13H8F2N2O4 — CID 103863233
2,3-difluoro-N-(2-hydroxy-5-nitrophenyl)benzamide (PubChem CID 103863233) has the molecular formula C13H8F2N2O4 and a molecular weight of 294.21 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-hydroxy-5-nitrophenyl)benzamide.
| Compound Name | 2,3-difluoro-N-(2-hydroxy-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 103863233 |
| Molecular Formula | C13H8F2N2O4 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2,3-difluoro-N-(2-hydroxy-5-nitrophenyl)benzamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)c1cccc(F)c1F |
| InChI | InChI=1S/C13H8F2N2O4/c14-9-3-1-2-8(12(9)15)13(19)16-10-6-7(17(20)21)4-5-11(10)18/h1-6,18H,(H,16,19) |
| InChIKey | MBHMRLAXHDXDQJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|