C12H17NO2 — CID 103863610
N,N-diethyl-4-hydroxy-2-methylbenzamide (PubChem CID 103863610) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N,N-diethyl-4-hydroxy-2-methylbenzamide.
| Compound Name | N,N-diethyl-4-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 103863610 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N,N-diethyl-4-hydroxy-2-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(O)cc1C |
| InChI | InChI=1S/C12H17NO2/c1-4-13(5-2)12(15)11-7-6-10(14)8-9(11)3/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | ZYMXOEIILFNKKC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |