C15H16N4O6S — CID 10386367
[5-[(4-methoxyphenyl)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 10386367) has the molecular formula C15H16N4O6S and a molecular weight of 380.38 g/mol. Its IUPAC name is [5-[(4-methoxyphenyl)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [5-[(4-methoxyphenyl)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 10386367 |
| Molecular Formula | C15H16N4O6S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [5-[(4-methoxyphenyl)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | COc1ccc(Cn2ncc3c2CN2CC3N(OS(=O)(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C15H16N4O6S/c1-24-11-4-2-10(3-5-11)7-18-13-8-17-9-14(12(13)6-16-18)19(15(17)20)25-26(21,22)23/h2-6,14H,7-9H2,1H3,(H,21,22,23) |
| InChIKey | YTAXUUFAWLVCIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|