C25H26N2O3 — CID 10386388
1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-(2-phenylphenyl)urea (PubChem CID 10386388) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 10386388 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]-3-(2-phenylphenyl)urea |
| SMILES | CC1(C)OC[C@H](NC(=O)Nc2ccccc2-c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C25H26N2O3/c1-25(2)29-17-22(23(30-25)19-13-7-4-8-14-19)27-24(28)26-21-16-10-9-15-20(21)18-11-5-3-6-12-18/h3-16,22-23H,17H2,1-2H3,(H2,26,27,28)/t22-,23-/m0/s1 |
| InChIKey | CHAUTNUHONEVFB-GOTSBHOMSA-N |
| XLogP | 5.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |