C17H24N2O — CID 103864389
2-cyclopropyl-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]oxolan-3-amine (PubChem CID 103864389) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]oxolan-3-amine.
| Compound Name | 2-cyclopropyl-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 103864389 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-cyclopropyl-N-[(1-methyl-2,3-dihydroindol-5-yl)methyl]oxolan-3-amine |
| SMILES | CN1CCc2cc(CNC3CCOC3C3CC3)ccc21 |
| InChI | InChI=1S/C17H24N2O/c1-19-8-6-14-10-12(2-5-16(14)19)11-18-15-7-9-20-17(15)13-3-4-13/h2,5,10,13,15,17-18H,3-4,6-9,11H2,1H3 |
| InChIKey | KJQBIHGNFLGNFL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|