C14H15BrFNO2 — CID 103864687
2-bromo-N-(2-cyclopropyloxolan-3-yl)-5-fluorobenzamide (PubChem CID 103864687) has the molecular formula C14H15BrFNO2 and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-bromo-N-(2-cyclopropyloxolan-3-yl)-5-fluorobenzamide.
| Compound Name | 2-bromo-N-(2-cyclopropyloxolan-3-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 103864687 |
| Molecular Formula | C14H15BrFNO2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-bromo-N-(2-cyclopropyloxolan-3-yl)-5-fluorobenzamide |
| SMILES | O=C(NC1CCOC1C1CC1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H15BrFNO2/c15-11-4-3-9(16)7-10(11)14(18)17-12-5-6-19-13(12)8-1-2-8/h3-4,7-8,12-13H,1-2,5-6H2,(H,17,18) |
| InChIKey | ALDGPXVPICPVQJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |