C23H19NO6 — CID 10386553
ethyl 16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxylate (PubChem CID 10386553) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is ethyl 16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxylate.
| Compound Name | ethyl 16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxylate |
|---|---|
| PubChem CID | 10386553 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | ethyl 16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaene-20-carboxylate |
| SMILES | CCOC(=O)c1cc2c3cc4c(cc3ncc2c2cc(OC)c(OC)cc12)OCO4 |
| InChI | InChI=1S/C23H19NO6/c1-4-28-23(25)16-5-12-15-8-21-22(30-11-29-21)9-18(15)24-10-17(12)14-7-20(27-3)19(26-2)6-13(14)16/h5-10H,4,11H2,1-3H3 |
| InChIKey | YMYIYTVJUDJNTI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|