About N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine
N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 103865931) has the molecular formula C6H9N3S2
and a molecular weight of 187.29 g/mol. Its IUPAC name is N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 103865931 |
| Molecular Formula | C6H9N3S2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NC2CCSC2)n1 |
| InChI | InChI=1S/C6H9N3S2/c1-2-10-3-5(1)9-6-7-4-8-11-6/h4-5H,1-3H2,(H,7,8,9) |
| InChIKey | YXRKOQNVOAKNCM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine (CID 103865931) is N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine is c1nsc(NC2CCSC2)n1.
What is the InChIKey of N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine?
The InChIKey is YXRKOQNVOAKNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S2/c1-2-10-3-5(1)9-6-7-4-8-11-6/h4-5H,1-3H2,(H,7,8,9).
What are the key properties of N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine?
N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine has a molecular weight of 187.29 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thiolan-3-yl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 103865931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).