C8H13N3S — CID 103865940
N-(2-propylcyclopropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 103865940) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N-(2-propylcyclopropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-propylcyclopropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103865940 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-(2-propylcyclopropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCC1CC1Nc1ncns1 |
| InChI | InChI=1S/C8H13N3S/c1-2-3-6-4-7(6)11-8-9-5-10-12-8/h5-7H,2-4H2,1H3,(H,9,10,11) |
| InChIKey | BEIAPGGOLMNCCV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |