C9H17F2NO — CID 103867022
2-[cyclobutylmethyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 103867022) has the molecular formula C9H17F2NO and a molecular weight of 193.24 g/mol. Its IUPAC name is 2-[cyclobutylmethyl(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[cyclobutylmethyl(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 103867022 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-[cyclobutylmethyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)F)CC1CCC1 |
| InChI | InChI=1S/C9H17F2NO/c10-9(11)7-12(4-5-13)6-8-2-1-3-8/h8-9,13H,1-7H2 |
| InChIKey | DNUMEQNMAJFNNE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |