C10H12Br2N2O — CID 103867576
3-(2,6-dibromophenyl)-1-ethyl-1-methylurea (PubChem CID 103867576) has the molecular formula C10H12Br2N2O and a molecular weight of 336.03 g/mol. Its IUPAC name is 3-(2,6-dibromophenyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(2,6-dibromophenyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 103867576 |
| Molecular Formula | C10H12Br2N2O |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 3-(2,6-dibromophenyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C10H12Br2N2O/c1-3-14(2)10(15)13-9-7(11)5-4-6-8(9)12/h4-6H,3H2,1-2H3,(H,13,15) |
| InChIKey | SOOQFAJAMMTZSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |