C24H31NO3Si — CID 10386808
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]propanal (PubChem CID 10386808) has the molecular formula C24H31NO3Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]propanal.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]propanal |
|---|---|
| PubChem CID | 10386808 |
| Molecular Formula | C24H31NO3Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC=O)C1=NO[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H31NO3Si/c1-24(2,3)29(4,5)28-20(16-17-26)22-21(18-12-8-6-9-13-18)23(27-25-22)19-14-10-7-11-15-19/h6-15,17,20-21,23H,16H2,1-5H3/t20-,21-,23+/m0/s1 |
| InChIKey | RZCOSNUQDGPVQR-QNWVGRARSA-N |
| XLogP | 5.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|