About 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide
1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (PubChem CID 103868094) has the molecular formula C8H11N3O3S2
and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| PubChem CID | 103868094 |
| Molecular Formula | C8H11N3O3S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| SMILES | CCC(C#N)S(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O3S2/c1-2-7(3-9)16(13,14)10-4-6-5-15-8(12)11-6/h5,7,10H,2,4H2,1H3,(H,11,12) |
| InChIKey | LRKFDXLUFWTVGT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The IUPAC name of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (CID 103868094) is 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
What is the SMILES notation for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The canonical SMILES for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is CCC(C#N)S(=O)(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The InChIKey is LRKFDXLUFWTVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S2/c1-2-7(3-9)16(13,14)10-4-6-5-15-8(12)11-6/h5,7,10H,2,4H2,1H3,(H,11,12).
What are the key properties of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide has a molecular weight of 261.33 g/mol, XLogP of 0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is sourced from PubChem (CID 103868094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).