About 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide
1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide (PubChem CID 103868100) has the molecular formula C6H7N3O3S2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide |
| PubChem CID | 103868100 |
| Molecular Formula | C6H7N3O3S2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide |
| SMILES | N#CCS(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H7N3O3S2/c7-1-2-14(11,12)8-3-5-4-13-6(10)9-5/h4,8H,2-3H2,(H,9,10) |
| InChIKey | VWPVOCOFOXOVPF-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide?
The IUPAC name of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide (CID 103868100) is 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide.
What is the SMILES notation for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide?
The canonical SMILES for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide is N#CCS(=O)(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide?
The InChIKey is VWPVOCOFOXOVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3S2/c7-1-2-14(11,12)8-3-5-4-13-6(10)9-5/h4,8H,2-3H2,(H,9,10).
What are the key properties of 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide?
1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide has a molecular weight of 233.27 g/mol, XLogP of -0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]methanesulfonamide is sourced from PubChem (CID 103868100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).