About 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine
2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine (PubChem CID 10386823) has the molecular formula C18H19N3O2S2
and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine |
| PubChem CID | 10386823 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine |
| SMILES | O=S(=O)(Cc1ccccc1)c1cc2c(N3CCNCC3)nccc2s1 |
| InChI | InChI=1S/C18H19N3O2S2/c22-25(23,13-14-4-2-1-3-5-14)17-12-15-16(24-17)6-7-20-18(15)21-10-8-19-9-11-21/h1-7,12,19H,8-11,13H2 |
| InChIKey | YQWIEBKOFBHKCM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine?
The IUPAC name of 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine (CID 10386823) is 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine.
What is the SMILES notation for 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine?
The canonical SMILES for 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine is O=S(=O)(Cc1ccccc1)c1cc2c(N3CCNCC3)nccc2s1.
What is the InChIKey of 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine?
The InChIKey is YQWIEBKOFBHKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S2/c22-25(23,13-14-4-2-1-3-5-14)17-12-15-16(24-17)6-7-20-18(15)21-10-8-19-9-11-21/h1-7,12,19H,8-11,13H2.
What are the key properties of 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine?
2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine has a molecular weight of 373.50 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonyl-4-piperazin-1-ylthieno[3,2-c]pyridine is sourced from PubChem (CID 10386823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).