C12H19F4NO2 — CID 103868600
N-(2,2-diethyloxan-4-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103868600) has the molecular formula C12H19F4NO2 and a molecular weight of 285.28 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2,2-diethyloxan-4-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103868600 |
| Molecular Formula | C12H19F4NO2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCC1(CC)CC(NC(=O)C(F)(F)C(F)F)CCO1 |
| InChI | InChI=1S/C12H19F4NO2/c1-3-11(4-2)7-8(5-6-19-11)17-10(18)12(15,16)9(13)14/h8-9H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | RGXSICOQADULCO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|