C24H29NO5 — CID 10386927
(2R,4S)-4-(5-carboxypentanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid (PubChem CID 10386927) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (2R,4S)-4-(5-carboxypentanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid.
| Compound Name | (2R,4S)-4-(5-carboxypentanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 10386927 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2R,4S)-4-(5-carboxypentanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| SMILES | C[C@H](C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H29NO5/c1-17(24(29)30)15-21(25-22(26)9-5-6-10-23(27)28)16-18-11-13-20(14-12-18)19-7-3-2-4-8-19/h2-4,7-8,11-14,17,21H,5-6,9-10,15-16H2,1H3,(H,25,26)(H,27,28)(H,29,30)/t17-,21+/m1/s1 |
| InChIKey | IWURQOHGXLKXDJ-UTKZUKDTSA-N |
| XLogP | 4.14 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|