C12H18N4O3 — CID 103870452
(2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 103870452) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 103870452 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC1(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H18N4O3/c13-12(3-1-2-4-12)11(19)16-9(10(17)18)5-8-6-14-7-15-8/h6-7,9H,1-5,13H2,(H,14,15)(H,16,19)(H,17,18)/t9-/m1/s1 |
| InChIKey | YERBWHZVDGSJTO-SECBINFHSA-N |
| XLogP | -0.21 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |