About [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate (PubChem CID 10387091) has the molecular formula C24H30O6
and a molecular weight of 414.50 g/mol. Its IUPAC name is [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate.
Molecular Properties
| Compound Name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate |
| PubChem CID | 10387091 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate |
| SMILES | CC(C)=CCC(OC(=O)CCCCC(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C24H30O6/c1-14(2)7-5-6-8-21(28)30-20(12-9-15(3)4)16-13-19(27)22-17(25)10-11-18(26)23(22)24(16)29/h9-11,13-14,20,25-26H,5-8,12H2,1-4H3 |
| InChIKey | DJRBQYQOLYGEOI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate?
The IUPAC name of [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate (CID 10387091) is [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate.
What is the SMILES notation for [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate?
The canonical SMILES for [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate is CC(C)=CCC(OC(=O)CCCCC(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O.
What is the InChIKey of [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate?
The InChIKey is DJRBQYQOLYGEOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O6/c1-14(2)7-5-6-8-21(28)30-20(12-9-15(3)4)16-13-19(27)22-17(25)10-11-18(26)23(22)24(16)29/h9-11,13-14,20,25-26H,5-8,12H2,1-4H3.
What are the key properties of [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate?
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate has a molecular weight of 414.50 g/mol, XLogP of 4.89, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 6-methylheptanoate is sourced from PubChem (CID 10387091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).