C14H19NO3S — CID 103871391
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3-methylpyrrolidin-3-ol (PubChem CID 103871391) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3-methylpyrrolidin-3-ol.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103871391 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(S(=O)(=O)c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C14H19NO3S/c1-14(16)7-8-15(10-14)19(17,18)13-6-5-11-3-2-4-12(11)9-13/h5-6,9,16H,2-4,7-8,10H2,1H3 |
| InChIKey | IYJDENVOYZUUDU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |