C17H17F2NO5S2 — CID 10387245
2-[2,6-difluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid (PubChem CID 10387245) has the molecular formula C17H17F2NO5S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-difluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10387245 |
| Molecular Formula | C17H17F2NO5S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-[2,6-difluoro-4-[2-[(4-methylphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCSc2cc(F)c(OCC(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H17F2NO5S2/c1-11-2-4-13(5-3-11)27(23,24)20-6-7-26-12-8-14(18)17(15(19)9-12)25-10-16(21)22/h2-5,8-9,20H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | MPNSHCXTLICUNT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|