C10H9ClN4O — CID 103872553
4-chloro-N-(5-methyl-1H-pyrazol-3-yl)pyridine-3-carboxamide (PubChem CID 103872553) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is 4-chloro-N-(5-methyl-1H-pyrazol-3-yl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(5-methyl-1H-pyrazol-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103872553 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 4-chloro-N-(5-methyl-1H-pyrazol-3-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnccc2Cl)n[nH]1 |
| InChI | InChI=1S/C10H9ClN4O/c1-6-4-9(15-14-6)13-10(16)7-5-12-3-2-8(7)11/h2-5H,1H3,(H2,13,14,15,16) |
| InChIKey | RWHUESPBHPZCTL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |