C23H30O7 — CID 10387286
(8R)-7'-formyl-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-6'-carboxylic acid (PubChem CID 10387286) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is (8R)-7'-formyl-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-6'-carboxylic acid.
| Compound Name | (8R)-7'-formyl-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-6'-carboxylic acid |
|---|---|
| PubChem CID | 10387286 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (8R)-7'-formyl-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-6'-carboxylic acid |
| SMILES | CC1CCC2C(C)(C)C(O)C(O)CC2(C)[C@@]12Cc1c(O)cc(C(=O)O)c(C=O)c1O2 |
| InChI | InChI=1S/C23H30O7/c1-11-5-6-17-21(2,3)19(27)16(26)9-22(17,4)23(11)8-13-15(25)7-12(20(28)29)14(10-24)18(13)30-23/h7,10-11,16-17,19,25-27H,5-6,8-9H2,1-4H3,(H,28,29)/t11?,16?,17?,19?,22?,23-/m1/s1 |
| InChIKey | FXPGXEFCMZHWPO-GQERJLHYSA-N |
| XLogP | 2.78 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|