C18H23FMgN4O5 — CID 10387321
magnesium (2S)-N-(5-fluoro-1-oxido-2-pyridinylidene)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 10387321) has the molecular formula C18H23FMgN4O5 and a molecular weight of 418.71 g/mol. Its IUPAC name is magnesium (2S)-N-(5-fluoro-1-oxido-2-pyridinylidene)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | magnesium (2S)-N-(5-fluoro-1-oxido-2-pyridinylidene)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10387321 |
| Molecular Formula | C18H23FMgN4O5 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | magnesium (2S)-N-(5-fluoro-1-oxido-2-pyridinylidene)-1-[(2R)-2-[[formyl(oxido)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](CN([O-])C=O)C(=O)N1CCC[C@H]1C(=O)/N=c1\ccc(F)cn1[O-].[Mg+2] |
| InChI | InChI=1S/C18H23FN4O5.Mg/c1-2-3-5-13(10-21(27)12-24)18(26)22-9-4-6-15(22)17(25)20-16-8-7-14(19)11-23(16)28;/h7-8,11-13,15H,2-6,9-10H2,1H3;/q-2;+2/b20-16+;/t13-,15+;/m1./s1 |
| InChIKey | XMRVYNKCKDMVDU-IMKGVRLASA-N |
| XLogP | 0.77 |
| TPSA | 121.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|