C10H11IN2O2 — CID 103873257
(2S)-N-(5-iodo-2-pyridinyl)oxolane-2-carboxamide (PubChem CID 103873257) has the molecular formula C10H11IN2O2 and a molecular weight of 318.11 g/mol. Its IUPAC name is (2S)-N-(5-iodo-2-pyridinyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(5-iodo-2-pyridinyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 103873257 |
| Molecular Formula | C10H11IN2O2 |
| Molecular Weight | 318.11 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (2S)-N-(5-iodo-2-pyridinyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cn1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C10H11IN2O2/c11-7-3-4-9(12-6-7)13-10(14)8-2-1-5-15-8/h3-4,6,8H,1-2,5H2,(H,12,13,14)/t8-/m0/s1 |
| InChIKey | KOIXKOYTSLDHPJ-QMMMGPOBSA-N |
| XLogP | 1.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.11 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|