C12H11BrN2O2S — CID 103873486
4-bromo-3-hydroxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 103873486) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-bromo-3-hydroxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 4-bromo-3-hydroxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103873486 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-bromo-3-hydroxy-N-[(5-methyl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | Cc1cnc(CNC(=O)c2ccc(Br)c(O)c2)s1 |
| InChI | InChI=1S/C12H11BrN2O2S/c1-7-5-14-11(18-7)6-15-12(17)8-2-3-9(13)10(16)4-8/h2-5,16H,6H2,1H3,(H,15,17) |
| InChIKey | YTDKXSQCBDPDAU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |