C7H11F4NO2 — CID 103874502
2,2,3,3-tetrafluoro-N-(1-hydroxypropan-2-yl)-N-methylpropanamide (PubChem CID 103874502) has the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(1-hydroxypropan-2-yl)-N-methylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(1-hydroxypropan-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 103874502 |
| Molecular Formula | C7H11F4NO2 |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(1-hydroxypropan-2-yl)-N-methylpropanamide |
| SMILES | CC(CO)N(C)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H11F4NO2/c1-4(3-13)12(2)6(14)7(10,11)5(8)9/h4-5,13H,3H2,1-2H3 |
| InChIKey | LXLFRCYVRNMFAY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|