C14H18N2O3 — CID 103877617
N-(3-hydroxy-4-methoxybutyl)-1H-indole-6-carboxamide (PubChem CID 103877617) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(3-hydroxy-4-methoxybutyl)-1H-indole-6-carboxamide.
| Compound Name | N-(3-hydroxy-4-methoxybutyl)-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 103877617 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(3-hydroxy-4-methoxybutyl)-1H-indole-6-carboxamide |
| SMILES | COCC(O)CCNC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C14H18N2O3/c1-19-9-12(17)5-7-16-14(18)11-3-2-10-4-6-15-13(10)8-11/h2-4,6,8,12,15,17H,5,7,9H2,1H3,(H,16,18) |
| InChIKey | QLNALTLYAXFQPA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |