C20H28O10 — CID 10387847
[(2R,3S)-6-oxo-2-[(1S,2R,3S)-1,2,3-triacetyloxyheptyl]-2,3-dihydropyran-3-yl] acetate (PubChem CID 10387847) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is [(2R,3S)-6-oxo-2-[(1S,2R,3S)-1,2,3-triacetyloxyheptyl]-2,3-dihydropyran-3-yl] acetate.
| Compound Name | [(2R,3S)-6-oxo-2-[(1S,2R,3S)-1,2,3-triacetyloxyheptyl]-2,3-dihydropyran-3-yl] acetate |
|---|---|
| PubChem CID | 10387847 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [(2R,3S)-6-oxo-2-[(1S,2R,3S)-1,2,3-triacetyloxyheptyl]-2,3-dihydropyran-3-yl] acetate |
| SMILES | CCCC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(=O)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H28O10/c1-6-7-8-15(26-11(2)21)18(28-13(4)23)20(29-14(5)24)19-16(27-12(3)22)9-10-17(25)30-19/h9-10,15-16,18-20H,6-8H2,1-5H3/t15-,16-,18+,19+,20-/m0/s1 |
| InChIKey | MORVXKHVGBWREP-UFHDJZAFSA-N |
| XLogP | 1.38 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|