C20H26F2N2O4S — CID 10387863
2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid (PubChem CID 10387863) has the molecular formula C20H26F2N2O4S and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid.
| Compound Name | 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10387863 |
| Molecular Formula | C20H26F2N2O4S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
| SMILES | CC(SCCCCN1C(=O)NC[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H26F2N2O4S/c1-14(18(26)27)29-12-6-5-11-24-16(13-23-19(24)28)9-10-17(25)20(21,22)15-7-3-2-4-8-15/h2-4,7-10,14,16-17,25H,5-6,11-13H2,1H3,(H,23,28)(H,26,27)/b10-9+/t14?,16-,17?/m0/s1 |
| InChIKey | ULSVNAJUBUXWAC-LQHYEFTKSA-N |
| XLogP | 3.08 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|