C15H21F2NO2 — CID 103878793
N-[2-ethyl-2-(hydroxymethyl)butyl]-2,6-difluoro-3-methylbenzamide (PubChem CID 103878793) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[2-ethyl-2-(hydroxymethyl)butyl]-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 103878793 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2,6-difluoro-3-methylbenzamide |
| SMILES | CCC(CC)(CO)CNC(=O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C15H21F2NO2/c1-4-15(5-2,9-19)8-18-14(20)12-11(16)7-6-10(3)13(12)17/h6-7,19H,4-5,8-9H2,1-3H3,(H,18,20) |
| InChIKey | IBNUSJTXOWSDAW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |