C11H11ClN2O6 — CID 103879220
methyl 3-[(2-chloro-4-nitrobenzoyl)amino]-2-hydroxypropanoate (PubChem CID 103879220) has the molecular formula C11H11ClN2O6 and a molecular weight of 302.67 g/mol. Its IUPAC name is methyl 3-[(2-chloro-4-nitrobenzoyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(2-chloro-4-nitrobenzoyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879220 |
| Molecular Formula | C11H11ClN2O6 |
| Molecular Weight | 302.67 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | methyl 3-[(2-chloro-4-nitrobenzoyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H11ClN2O6/c1-20-11(17)9(15)5-13-10(16)7-3-2-6(14(18)19)4-8(7)12/h2-4,9,15H,5H2,1H3,(H,13,16) |
| InChIKey | DBJZASRGVQSBSN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.67 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|