C16H23NO4 — CID 103879388
methyl 3-[[2-(4-butylphenyl)acetyl]amino]-2-hydroxypropanoate (PubChem CID 103879388) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 3-[[2-(4-butylphenyl)acetyl]amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[[2-(4-butylphenyl)acetyl]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879388 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 3-[[2-(4-butylphenyl)acetyl]amino]-2-hydroxypropanoate |
| SMILES | CCCCc1ccc(CC(=O)NCC(O)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-3-4-5-12-6-8-13(9-7-12)10-15(19)17-11-14(18)16(20)21-2/h6-9,14,18H,3-5,10-11H2,1-2H3,(H,17,19) |
| InChIKey | GNFUXIISGCHUBP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |