About 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid
2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid (PubChem CID 10387973) has the molecular formula C22H19FO6S
and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid |
| PubChem CID | 10387973 |
| Molecular Formula | C22H19FO6S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)cc(C)c1Oc1ccc(O)c(S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19FO6S/c1-13-9-15(11-21(25)26)10-14(2)22(13)29-17-5-8-19(24)20(12-17)30(27,28)18-6-3-16(23)4-7-18/h3-10,12,24H,11H2,1-2H3,(H,25,26) |
| InChIKey | WCBUZXBDNMVGOX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid?
The IUPAC name of 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid (CID 10387973) is 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid.
What is the SMILES notation for 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid?
The canonical SMILES for 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid is Cc1cc(CC(=O)O)cc(C)c1Oc1ccc(O)c(S(=O)(=O)c2ccc(F)cc2)c1.
What is the InChIKey of 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid?
The InChIKey is WCBUZXBDNMVGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FO6S/c1-13-9-15(11-21(25)26)10-14(2)22(13)29-17-5-8-19(24)20(12-17)30(27,28)18-6-3-16(23)4-7-18/h3-10,12,24H,11H2,1-2H3,(H,25,26).
What are the key properties of 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid?
2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid has a molecular weight of 430.45 g/mol, XLogP of 4.40, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylphenyl]acetic acid is sourced from PubChem (CID 10387973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).