About tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane
tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane (PubChem CID 10388012) has the molecular formula C21H44OSn
and a molecular weight of 431.29 g/mol. Its IUPAC name is tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane |
| PubChem CID | 10388012 |
| Molecular Formula | C21H44OSn |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(/C=C\OCC)C(C)(C)C |
| InChI | InChI=1S/C9H17O.3C4H9.Sn/c1-5-10-8-6-7-9(2,3)4;3*1-3-4-2;/h6-8H,5H2,1-4H3;3*1,3-4H2,2H3;/b8-6-;;;; |
| InChIKey | NNCJLBJZNBOLHL-SKAPHXEVSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane?
The IUPAC name of tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane (CID 10388012) is tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane.
What is the SMILES notation for tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane?
The canonical SMILES for tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane is CCCC[Sn](CCCC)(CCCC)C(/C=C\OCC)C(C)(C)C.
What is the InChIKey of tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane?
The InChIKey is NNCJLBJZNBOLHL-SKAPHXEVSA-N. The full InChI is InChI=1S/C9H17O.3C4H9.Sn/c1-5-10-8-6-7-9(2,3)4;3*1-3-4-2;/h6-8H,5H2,1-4H3;3*1,3-4H2,2H3;/b8-6-;;;;.
What are the key properties of tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane?
tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane has a molecular weight of 431.29 g/mol, XLogP of 7.80, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(Z)-1-ethoxy-4,4-dimethylpent-1-en-3-yl]stannane is sourced from PubChem (CID 10388012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).