C12H16F3N3O — CID 103880351
N-[(4-methyloxan-4-yl)methyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 103880351) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[(4-methyloxan-4-yl)methyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[(4-methyloxan-4-yl)methyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 103880351 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[(4-methyloxan-4-yl)methyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CC1(CNc2ccc(C(F)(F)F)nn2)CCOCC1 |
| InChI | InChI=1S/C12H16F3N3O/c1-11(4-6-19-7-5-11)8-16-10-3-2-9(17-18-10)12(13,14)15/h2-3H,4-8H2,1H3,(H,16,18) |
| InChIKey | QAVOUDOEDUEIMI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |