About N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine
N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 103880382) has the molecular formula C13H14F3N3
and a molecular weight of 269.27 g/mol. Its IUPAC name is N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine |
| PubChem CID | 103880382 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1ccc(NC2C3C4CCC(C4)C23)nn1 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)8-3-4-9(19-18-8)17-12-10-6-1-2-7(5-6)11(10)12/h3-4,6-7,10-12H,1-2,5H2,(H,17,19) |
| InChIKey | TYYXVTQQBQOEEB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine?
The IUPAC name of N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine (CID 103880382) is N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine.
What is the SMILES notation for N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine?
The canonical SMILES for N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine is FC(F)(F)c1ccc(NC2C3C4CCC(C4)C23)nn1.
What is the InChIKey of N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine?
The InChIKey is TYYXVTQQBQOEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3/c14-13(15,16)8-3-4-9(19-18-8)17-12-10-6-1-2-7(5-6)11(10)12/h3-4,6-7,10-12H,1-2,5H2,(H,17,19).
What are the key properties of N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine?
N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine has a molecular weight of 269.27 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-tricyclo[3.2.1.02,4]octanyl)-6-(trifluoromethyl)pyridazin-3-amine is sourced from PubChem (CID 103880382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).