C15H22FN3O — CID 103880394
2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 103880394) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 103880394 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCc1ncnc(N2CCC3(O)CCCCC3C2)c1F |
| InChI | InChI=1S/C15H22FN3O/c1-2-12-13(16)14(18-10-17-12)19-8-7-15(20)6-4-3-5-11(15)9-19/h10-11,20H,2-9H2,1H3 |
| InChIKey | XNXZIHSVEMMOBY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |