C14H21N3O2 — CID 103880578
2-ethyl-2-[(1-methylindazol-3-yl)methylamino]propane-1,3-diol (PubChem CID 103880578) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-ethyl-2-[(1-methylindazol-3-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[(1-methylindazol-3-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 103880578 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-ethyl-2-[(1-methylindazol-3-yl)methylamino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)NCc1nn(C)c2ccccc12 |
| InChI | InChI=1S/C14H21N3O2/c1-3-14(9-18,10-19)15-8-12-11-6-4-5-7-13(11)17(2)16-12/h4-7,15,18-19H,3,8-10H2,1-2H3 |
| InChIKey | OVVPCPFFNPBPJG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |