C23H30Cl2N4 — CID 10388138
N-butyl-3-(2,4-dichlorophenyl)-1,5-dimethyl-N-pentylpyrazolo[4,3-b]pyridin-7-amine (PubChem CID 10388138) has the molecular formula C23H30Cl2N4 and a molecular weight of 433.43 g/mol. Its IUPAC name is N-butyl-3-(2,4-dichlorophenyl)-1,5-dimethyl-N-pentylpyrazolo[4,3-b]pyridin-7-amine.
| Compound Name | N-butyl-3-(2,4-dichlorophenyl)-1,5-dimethyl-N-pentylpyrazolo[4,3-b]pyridin-7-amine |
|---|---|
| PubChem CID | 10388138 |
| Molecular Formula | C23H30Cl2N4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-butyl-3-(2,4-dichlorophenyl)-1,5-dimethyl-N-pentylpyrazolo[4,3-b]pyridin-7-amine |
| SMILES | CCCCCN(CCCC)c1cc(C)nc2c(-c3ccc(Cl)cc3Cl)nn(C)c12 |
| InChI | InChI=1S/C23H30Cl2N4/c1-5-7-9-13-29(12-8-6-2)20-14-16(3)26-22-21(27-28(4)23(20)22)18-11-10-17(24)15-19(18)25/h10-11,14-15H,5-9,12-13H2,1-4H3 |
| InChIKey | WJRNESDDMLZGJN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|