About 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide (PubChem CID 103881718) has the molecular formula C5H8ClF2NO2
and a molecular weight of 187.57 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| PubChem CID | 103881718 |
| Molecular Formula | C5H8ClF2NO2 |
| Molecular Weight | 187.57 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CCl)NCC(O)C(F)F |
| InChI | InChI=1S/C5H8ClF2NO2/c6-1-4(11)9-2-3(10)5(7)8/h3,5,10H,1-2H2,(H,9,11) |
| InChIKey | IZEVWDNLXBRXIM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.57 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide (CID 103881718) is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
What is the SMILES notation for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The canonical SMILES for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide is O=C(CCl)NCC(O)C(F)F.
What is the InChIKey of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The InChIKey is IZEVWDNLXBRXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClF2NO2/c6-1-4(11)9-2-3(10)5(7)8/h3,5,10H,1-2H2,(H,9,11).
What are the key properties of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide has a molecular weight of 187.57 g/mol, XLogP of -0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)acetamide is sourced from PubChem (CID 103881718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).