C21H21F2NO5S — CID 10388363
5-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propyl]furan-2-carboxylic acid (PubChem CID 10388363) has the molecular formula C21H21F2NO5S and a molecular weight of 437.46 g/mol. Its IUPAC name is 5-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 10388363 |
| Molecular Formula | C21H21F2NO5S |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 5-[3-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]propyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCN2C(=O)SCC2/C=C/C(O)C(F)(F)c2ccccc2)o1 |
| InChI | InChI=1S/C21H21F2NO5S/c22-21(23,14-5-2-1-3-6-14)18(25)11-8-15-13-30-20(28)24(15)12-4-7-16-9-10-17(29-16)19(26)27/h1-3,5-6,8-11,15,18,25H,4,7,12-13H2,(H,26,27)/b11-8+ |
| InChIKey | KJPBDTQBSDFFRS-DHZHZOJOSA-N |
| XLogP | 4.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|