C21H26F3N5O2 — CID 10388364
5-[1-(4-methoxyphenyl)-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]-N,N-dimethylpentanimidamide (PubChem CID 10388364) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]-N,N-dimethylpentanimidamide.
| Compound Name | 5-[1-(4-methoxyphenyl)-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]-N,N-dimethylpentanimidamide |
|---|---|
| PubChem CID | 10388364 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]-N,N-dimethylpentanimidamide |
| SMILES | [H]/N=C(/CCCCN1CCc2c(C(F)(F)F)nn(-c3ccc(OC)cc3)c2C1=O)N(C)C |
| InChI | InChI=1S/C21H26F3N5O2/c1-27(2)17(25)6-4-5-12-28-13-11-16-18(20(28)30)29(26-19(16)21(22,23)24)14-7-9-15(31-3)10-8-14/h7-10,25H,4-6,11-13H2,1-3H3/b25-17- |
| InChIKey | YLHXTURVXFCOFA-UQQQWYQISA-N |
| XLogP | 3.61 |
| TPSA | 74.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|