C11H23N3O2S — CID 103885028
(2S)-2-amino-3-methyl-N-[2-(1-methylsulfanylpropan-2-ylamino)-2-oxoethyl]butanamide (PubChem CID 103885028) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-(1-methylsulfanylpropan-2-ylamino)-2-oxoethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-(1-methylsulfanylpropan-2-ylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 103885028 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-(1-methylsulfanylpropan-2-ylamino)-2-oxoethyl]butanamide |
| SMILES | CSCC(C)NC(=O)CNC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C11H23N3O2S/c1-7(2)10(12)11(16)13-5-9(15)14-8(3)6-17-4/h7-8,10H,5-6,12H2,1-4H3,(H,13,16)(H,14,15)/t8?,10-/m0/s1 |
| InChIKey | WREBJETUABYJLL-HTLJXXAVSA-N |
| XLogP | -0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |