C17H14F6N2O5 — CID 10388514
2-[3,5-bis(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid (PubChem CID 10388514) has the molecular formula C17H14F6N2O5 and a molecular weight of 440.30 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 10388514 |
| Molecular Formula | C17H14F6N2O5 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-6-oxopyrimidine-5-carboxylic acid |
| SMILES | COC(Cn1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ncc(C(=O)O)c1=O)OC |
| InChI | InChI=1S/C17H14F6N2O5/c1-29-12(30-2)7-25-13(24-6-11(14(25)26)15(27)28)8-3-9(16(18,19)20)5-10(4-8)17(21,22)23/h3-6,12H,7H2,1-2H3,(H,27,28) |
| InChIKey | LPBYCQBJNQIGFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|